About (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl morpholine-4-carbodithioate
(4-amino-6-anilino-1,3,5-triazin-2-yl)methyl morpholine-4-carbodithioate (PubChem CID 1319484) has the molecular formula C15H18N6OS2
and a molecular weight of 362.48 g/mol. Its IUPAC name is (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl morpholine-4-carbodithioate.
Molecular Properties
| Compound Name | (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl morpholine-4-carbodithioate |
| PubChem CID | 1319484 |
| Molecular Formula | C15H18N6OS2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl morpholine-4-carbodithioate |
| SMILES | Nc1nc(CSC(=S)N2CCOCC2)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C15H18N6OS2/c16-13-18-12(10-24-15(23)21-6-8-22-9-7-21)19-14(20-13)17-11-4-2-1-3-5-11/h1-5H,6-10H2,(H3,16,17,18,19,20) |
| InChIKey | VBICQALTTROOEN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl morpholine-4-carbodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl morpholine-4-carbodithioate?
The IUPAC name of (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl morpholine-4-carbodithioate (CID 1319484) is (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl morpholine-4-carbodithioate.
What is the SMILES notation for (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl morpholine-4-carbodithioate?
The canonical SMILES for (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl morpholine-4-carbodithioate is Nc1nc(CSC(=S)N2CCOCC2)nc(Nc2ccccc2)n1.
What is the InChIKey of (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl morpholine-4-carbodithioate?
The InChIKey is VBICQALTTROOEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N6OS2/c16-13-18-12(10-24-15(23)21-6-8-22-9-7-21)19-14(20-13)17-11-4-2-1-3-5-11/h1-5H,6-10H2,(H3,16,17,18,19,20).
What are the key properties of (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl morpholine-4-carbodithioate?
(4-amino-6-anilino-1,3,5-triazin-2-yl)methyl morpholine-4-carbodithioate has a molecular weight of 362.48 g/mol, XLogP of 2.05, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl morpholine-4-carbodithioate is sourced from PubChem (CID 1319484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).