C17H20N2O2S — CID 131948660
1,6-dimethyl-N-[(5-methylthiophen-2-yl)methyl]-4-oxo-N-prop-2-enylpyridine-3-carboxamide (PubChem CID 131948660) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is 1,6-dimethyl-N-[(5-methylthiophen-2-yl)methyl]-4-oxo-N-prop-2-enylpyridine-3-carboxamide.
| Compound Name | 1,6-dimethyl-N-[(5-methylthiophen-2-yl)methyl]-4-oxo-N-prop-2-enylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 131948660 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 1,6-dimethyl-N-[(5-methylthiophen-2-yl)methyl]-4-oxo-N-prop-2-enylpyridine-3-carboxamide |
| SMILES | C=CCN(Cc1ccc(C)s1)C(=O)c1cn(C)c(C)cc1=O |
| InChI | InChI=1S/C17H20N2O2S/c1-5-8-19(10-14-7-6-13(3)22-14)17(21)15-11-18(4)12(2)9-16(15)20/h5-7,9,11H,1,8,10H2,2-4H3 |
| InChIKey | LNOCAMQSJSYVGL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|