C9H14O4 — CID 13194898
methyl 5-(hydroxymethyl)-2-methoxycyclopentene-1-carboxylate (PubChem CID 13194898) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is methyl 5-(hydroxymethyl)-2-methoxycyclopentene-1-carboxylate.
| Compound Name | methyl 5-(hydroxymethyl)-2-methoxycyclopentene-1-carboxylate |
|---|---|
| PubChem CID | 13194898 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | methyl 5-(hydroxymethyl)-2-methoxycyclopentene-1-carboxylate |
| SMILES | COC(=O)C1=C(OC)CCC1CO |
| InChI | InChI=1S/C9H14O4/c1-12-7-4-3-6(5-10)8(7)9(11)13-2/h6,10H,3-5H2,1-2H3 |
| InChIKey | UEAFRDDPFPBNHA-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |