About N-[(4-chloro-3-pyridinyl)methyl]-N'-cyclopentyl-N,N'-dimethylethane-1,2-diamine
N-[(4-chloro-3-pyridinyl)methyl]-N'-cyclopentyl-N,N'-dimethylethane-1,2-diamine (PubChem CID 131949946) has the molecular formula C15H24ClN3
and a molecular weight of 281.83 g/mol. Its IUPAC name is N-[(4-chloro-3-pyridinyl)methyl]-N'-cyclopentyl-N,N'-dimethylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-[(4-chloro-3-pyridinyl)methyl]-N'-cyclopentyl-N,N'-dimethylethane-1,2-diamine |
| PubChem CID | 131949946 |
| Molecular Formula | C15H24ClN3 |
| Molecular Weight | 281.83 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | N-[(4-chloro-3-pyridinyl)methyl]-N'-cyclopentyl-N,N'-dimethylethane-1,2-diamine |
| SMILES | CN(CCN(C)C1CCCC1)Cc1cnccc1Cl |
| InChI | InChI=1S/C15H24ClN3/c1-18(12-13-11-17-8-7-15(13)16)9-10-19(2)14-5-3-4-6-14/h7-8,11,14H,3-6,9-10,12H2,1-2H3 |
| InChIKey | HMEDNGWNFQZXPB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.83 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(4-chloro-3-pyridinyl)methyl]-N'-cyclopentyl-N,N'-dimethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-chloro-3-pyridinyl)methyl]-N'-cyclopentyl-N,N'-dimethylethane-1,2-diamine?
The IUPAC name of N-[(4-chloro-3-pyridinyl)methyl]-N'-cyclopentyl-N,N'-dimethylethane-1,2-diamine (CID 131949946) is N-[(4-chloro-3-pyridinyl)methyl]-N'-cyclopentyl-N,N'-dimethylethane-1,2-diamine.
What is the SMILES notation for N-[(4-chloro-3-pyridinyl)methyl]-N'-cyclopentyl-N,N'-dimethylethane-1,2-diamine?
The canonical SMILES for N-[(4-chloro-3-pyridinyl)methyl]-N'-cyclopentyl-N,N'-dimethylethane-1,2-diamine is CN(CCN(C)C1CCCC1)Cc1cnccc1Cl.
What is the InChIKey of N-[(4-chloro-3-pyridinyl)methyl]-N'-cyclopentyl-N,N'-dimethylethane-1,2-diamine?
The InChIKey is HMEDNGWNFQZXPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24ClN3/c1-18(12-13-11-17-8-7-15(13)16)9-10-19(2)14-5-3-4-6-14/h7-8,11,14H,3-6,9-10,12H2,1-2H3.
What are the key properties of N-[(4-chloro-3-pyridinyl)methyl]-N'-cyclopentyl-N,N'-dimethylethane-1,2-diamine?
N-[(4-chloro-3-pyridinyl)methyl]-N'-cyclopentyl-N,N'-dimethylethane-1,2-diamine has a molecular weight of 281.83 g/mol, XLogP of 3.04, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-chloro-3-pyridinyl)methyl]-N'-cyclopentyl-N,N'-dimethylethane-1,2-diamine is sourced from PubChem (CID 131949946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).