C13H18F3N3O — CID 131950582
5-cyclohex-3-en-1-yl-3-(2-methoxyethyl)-1-(2,2,2-trifluoroethyl)-1,2,4-triazole (PubChem CID 131950582) has the molecular formula C13H18F3N3O and a molecular weight of 289.30 g/mol. Its IUPAC name is 5-cyclohex-3-en-1-yl-3-(2-methoxyethyl)-1-(2,2,2-trifluoroethyl)-1,2,4-triazole.
| Compound Name | 5-cyclohex-3-en-1-yl-3-(2-methoxyethyl)-1-(2,2,2-trifluoroethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 131950582 |
| Molecular Formula | C13H18F3N3O |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 5-cyclohex-3-en-1-yl-3-(2-methoxyethyl)-1-(2,2,2-trifluoroethyl)-1,2,4-triazole |
| SMILES | COCCc1nc(C2CC=CCC2)n(CC(F)(F)F)n1 |
| InChI | InChI=1S/C13H18F3N3O/c1-20-8-7-11-17-12(10-5-3-2-4-6-10)19(18-11)9-13(14,15)16/h2-3,10H,4-9H2,1H3 |
| InChIKey | KKOGPVCVLNKEGT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|