C19H35N3O2 — CID 131950589
N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-1-(2-methoxyethyl)piperidine-4-carboxamide (PubChem CID 131950589) has the molecular formula C19H35N3O2 and a molecular weight of 337.51 g/mol. Its IUPAC name is N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-1-(2-methoxyethyl)piperidine-4-carboxamide.
| Compound Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-1-(2-methoxyethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 131950589 |
| Molecular Formula | C19H35N3O2 |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.27 |
| IUPAC Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-1-(2-methoxyethyl)piperidine-4-carboxamide |
| SMILES | COCCN1CCC(C(=O)NC[C@@H]2CCCN3CCCC[C@H]23)CC1 |
| InChI | InChI=1S/C19H35N3O2/c1-24-14-13-21-11-7-16(8-12-21)19(23)20-15-17-5-4-10-22-9-3-2-6-18(17)22/h16-18H,2-15H2,1H3,(H,20,23)/t17-,18+/m0/s1 |
| InChIKey | PQUVLEFTUCFWOV-ZWKOTPCHSA-N |
| XLogP | 1.73 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |