About 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-[(3-methoxy-2-pyridinyl)oxy]propan-2-ol
1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-[(3-methoxy-2-pyridinyl)oxy]propan-2-ol (PubChem CID 13195066) has the molecular formula C19H26N2O5
and a molecular weight of 362.43 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-[(3-methoxy-2-pyridinyl)oxy]propan-2-ol.
Molecular Properties
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-[(3-methoxy-2-pyridinyl)oxy]propan-2-ol |
| PubChem CID | 13195066 |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-[(3-methoxy-2-pyridinyl)oxy]propan-2-ol |
| SMILES | COc1ccc(CCNCC(O)COc2ncccc2OC)cc1OC |
| InChI | InChI=1S/C19H26N2O5/c1-23-16-7-6-14(11-18(16)25-3)8-10-20-12-15(22)13-26-19-17(24-2)5-4-9-21-19/h4-7,9,11,15,20,22H,8,10,12-13H2,1-3H3 |
| InChIKey | FGMBKOXKZWEZSS-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 82.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-[(3-methoxy-2-pyridinyl)oxy]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-[(3-methoxy-2-pyridinyl)oxy]propan-2-ol?
The IUPAC name of 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-[(3-methoxy-2-pyridinyl)oxy]propan-2-ol (CID 13195066) is 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-[(3-methoxy-2-pyridinyl)oxy]propan-2-ol.
What is the SMILES notation for 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-[(3-methoxy-2-pyridinyl)oxy]propan-2-ol?
The canonical SMILES for 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-[(3-methoxy-2-pyridinyl)oxy]propan-2-ol is COc1ccc(CCNCC(O)COc2ncccc2OC)cc1OC.
What is the InChIKey of 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-[(3-methoxy-2-pyridinyl)oxy]propan-2-ol?
The InChIKey is FGMBKOXKZWEZSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N2O5/c1-23-16-7-6-14(11-18(16)25-3)8-10-20-12-15(22)13-26-19-17(24-2)5-4-9-21-19/h4-7,9,11,15,20,22H,8,10,12-13H2,1-3H3.
What are the key properties of 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-[(3-methoxy-2-pyridinyl)oxy]propan-2-ol?
1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-[(3-methoxy-2-pyridinyl)oxy]propan-2-ol has a molecular weight of 362.43 g/mol, XLogP of 1.68, 11 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-[(3-methoxy-2-pyridinyl)oxy]propan-2-ol is sourced from PubChem (CID 13195066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).