C17H20N6O — CID 131951379
5-[(2,4-dimethyl-5,6-dihydrofuro[2,3-d]pyrimidin-6-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2-carbonitrile (PubChem CID 131951379) has the molecular formula C17H20N6O and a molecular weight of 324.39 g/mol. Its IUPAC name is 5-[(2,4-dimethyl-5,6-dihydrofuro[2,3-d]pyrimidin-6-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2-carbonitrile.
| Compound Name | 5-[(2,4-dimethyl-5,6-dihydrofuro[2,3-d]pyrimidin-6-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2-carbonitrile |
|---|---|
| PubChem CID | 131951379 |
| Molecular Formula | C17H20N6O |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 5-[(2,4-dimethyl-5,6-dihydrofuro[2,3-d]pyrimidin-6-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2-carbonitrile |
| SMILES | Cc1nc(C)c2c(n1)OC(CN1CCCn3nc(C#N)cc3C1)C2 |
| InChI | InChI=1S/C17H20N6O/c1-11-16-7-15(24-17(16)20-12(2)19-11)10-22-4-3-5-23-14(9-22)6-13(8-18)21-23/h6,15H,3-5,7,9-10H2,1-2H3 |
| InChIKey | ORFCQWFDMOFGAU-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 79.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |