About 2-(1-tert-butyl-5-pyrimidin-5-yl-1,2,4-triazol-3-yl)acetamide
2-(1-tert-butyl-5-pyrimidin-5-yl-1,2,4-triazol-3-yl)acetamide (PubChem CID 131951982) has the molecular formula C12H16N6O
and a molecular weight of 260.30 g/mol. Its IUPAC name is 2-(1-tert-butyl-5-pyrimidin-5-yl-1,2,4-triazol-3-yl)acetamide.
Molecular Properties
| Compound Name | 2-(1-tert-butyl-5-pyrimidin-5-yl-1,2,4-triazol-3-yl)acetamide |
| PubChem CID | 131951982 |
| Molecular Formula | C12H16N6O |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 2-(1-tert-butyl-5-pyrimidin-5-yl-1,2,4-triazol-3-yl)acetamide |
| SMILES | CC(C)(C)n1nc(CC(N)=O)nc1-c1cncnc1 |
| InChI | InChI=1S/C12H16N6O/c1-12(2,3)18-11(8-5-14-7-15-6-8)16-10(17-18)4-9(13)19/h5-7H,4H2,1-3H3,(H2,13,19) |
| InChIKey | GMPUAUQXOFUIRD-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 99.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(1-tert-butyl-5-pyrimidin-5-yl-1,2,4-triazol-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-tert-butyl-5-pyrimidin-5-yl-1,2,4-triazol-3-yl)acetamide?
The IUPAC name of 2-(1-tert-butyl-5-pyrimidin-5-yl-1,2,4-triazol-3-yl)acetamide (CID 131951982) is 2-(1-tert-butyl-5-pyrimidin-5-yl-1,2,4-triazol-3-yl)acetamide.
What is the SMILES notation for 2-(1-tert-butyl-5-pyrimidin-5-yl-1,2,4-triazol-3-yl)acetamide?
The canonical SMILES for 2-(1-tert-butyl-5-pyrimidin-5-yl-1,2,4-triazol-3-yl)acetamide is CC(C)(C)n1nc(CC(N)=O)nc1-c1cncnc1.
What is the InChIKey of 2-(1-tert-butyl-5-pyrimidin-5-yl-1,2,4-triazol-3-yl)acetamide?
The InChIKey is GMPUAUQXOFUIRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N6O/c1-12(2,3)18-11(8-5-14-7-15-6-8)16-10(17-18)4-9(13)19/h5-7H,4H2,1-3H3,(H2,13,19).
What are the key properties of 2-(1-tert-butyl-5-pyrimidin-5-yl-1,2,4-triazol-3-yl)acetamide?
2-(1-tert-butyl-5-pyrimidin-5-yl-1,2,4-triazol-3-yl)acetamide has a molecular weight of 260.30 g/mol, XLogP of 0.52, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-tert-butyl-5-pyrimidin-5-yl-1,2,4-triazol-3-yl)acetamide is sourced from PubChem (CID 131951982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).