C6H15NO10P2 — CID 131953448
[(2R,3S,4R,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)pyrrolidin-2-yl]methyl dihydrogen phosphate (PubChem CID 131953448) has the molecular formula C6H15NO10P2 and a molecular weight of 323.13 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)pyrrolidin-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)pyrrolidin-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 131953448 |
| Molecular Formula | C6H15NO10P2 |
| Molecular Weight | 323.13 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)pyrrolidin-2-yl]methyl dihydrogen phosphate |
| SMILES | O=P(O)(O)OC[C@H]1N[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C6H15NO10P2/c8-5-3(1-16-18(10,11)12)7-4(6(5)9)2-17-19(13,14)15/h3-9H,1-2H2,(H2,10,11,12)(H2,13,14,15)/t3-,4-,5-,6+/m1/s1 |
| InChIKey | JDMJAXIARMVOFV-KAZBKCHUSA-N |
| XLogP | -2.73 |
| TPSA | 186.01 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.13 |
| LogP ≤ 5 | -2.73 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|