About 3-(4-chlorophenyl)-6-methoxy-4,5-dimethylpyridazine
3-(4-chlorophenyl)-6-methoxy-4,5-dimethylpyridazine (PubChem CID 131953502) has the molecular formula C13H13ClN2O
and a molecular weight of 248.71 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-6-methoxy-4,5-dimethylpyridazine.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-6-methoxy-4,5-dimethylpyridazine |
| PubChem CID | 131953502 |
| Molecular Formula | C13H13ClN2O |
| Molecular Weight | 248.71 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 3-(4-chlorophenyl)-6-methoxy-4,5-dimethylpyridazine |
| SMILES | COc1nnc(-c2ccc(Cl)cc2)c(C)c1C |
| InChI | InChI=1S/C13H13ClN2O/c1-8-9(2)13(17-3)16-15-12(8)10-4-6-11(14)7-5-10/h4-7H,1-3H3 |
| InChIKey | PROOZMFBOUKEMX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.71 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-chlorophenyl)-6-methoxy-4,5-dimethylpyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-6-methoxy-4,5-dimethylpyridazine?
The IUPAC name of 3-(4-chlorophenyl)-6-methoxy-4,5-dimethylpyridazine (CID 131953502) is 3-(4-chlorophenyl)-6-methoxy-4,5-dimethylpyridazine.
What is the SMILES notation for 3-(4-chlorophenyl)-6-methoxy-4,5-dimethylpyridazine?
The canonical SMILES for 3-(4-chlorophenyl)-6-methoxy-4,5-dimethylpyridazine is COc1nnc(-c2ccc(Cl)cc2)c(C)c1C.
What is the InChIKey of 3-(4-chlorophenyl)-6-methoxy-4,5-dimethylpyridazine?
The InChIKey is PROOZMFBOUKEMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13ClN2O/c1-8-9(2)13(17-3)16-15-12(8)10-4-6-11(14)7-5-10/h4-7H,1-3H3.
What are the key properties of 3-(4-chlorophenyl)-6-methoxy-4,5-dimethylpyridazine?
3-(4-chlorophenyl)-6-methoxy-4,5-dimethylpyridazine has a molecular weight of 248.71 g/mol, XLogP of 3.42, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-6-methoxy-4,5-dimethylpyridazine is sourced from PubChem (CID 131953502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).