C21H33N2O5P — CID 131953569
[(1R,3R)-1-amino-3-(2-hexyl-1-oxo-3,4-dihydroisoquinolin-6-yl)cyclopentyl]methyl dihydrogen phosphate (PubChem CID 131953569) has the molecular formula C21H33N2O5P and a molecular weight of 424.48 g/mol. Its IUPAC name is [(1R,3R)-1-amino-3-(2-hexyl-1-oxo-3,4-dihydroisoquinolin-6-yl)cyclopentyl]methyl dihydrogen phosphate.
| Compound Name | [(1R,3R)-1-amino-3-(2-hexyl-1-oxo-3,4-dihydroisoquinolin-6-yl)cyclopentyl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 131953569 |
| Molecular Formula | C21H33N2O5P |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | [(1R,3R)-1-amino-3-(2-hexyl-1-oxo-3,4-dihydroisoquinolin-6-yl)cyclopentyl]methyl dihydrogen phosphate |
| SMILES | CCCCCCN1CCc2cc([C@@H]3CC[C@](N)(COP(=O)(O)O)C3)ccc2C1=O |
| InChI | InChI=1S/C21H33N2O5P/c1-2-3-4-5-11-23-12-9-17-13-16(6-7-19(17)20(23)24)18-8-10-21(22,14-18)15-28-29(25,26)27/h6-7,13,18H,2-5,8-12,14-15,22H2,1H3,(H2,25,26,27)/t18-,21-/m1/s1 |
| InChIKey | KYGVOWHDVOYFQK-WIYYLYMNSA-N |
| XLogP | 3.34 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|