C22H32N3O5P — CID 131953615
[(1R,3S)-1-amino-3-[(6R)-6-[(1-methylpyrazol-4-yl)methoxymethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate (PubChem CID 131953615) has the molecular formula C22H32N3O5P and a molecular weight of 449.49 g/mol. Its IUPAC name is [(1R,3S)-1-amino-3-[(6R)-6-[(1-methylpyrazol-4-yl)methoxymethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate.
| Compound Name | [(1R,3S)-1-amino-3-[(6R)-6-[(1-methylpyrazol-4-yl)methoxymethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 131953615 |
| Molecular Formula | C22H32N3O5P |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | [(1R,3S)-1-amino-3-[(6R)-6-[(1-methylpyrazol-4-yl)methoxymethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate |
| SMILES | Cn1cc(COC[C@@H]2CCc3cc([C@H]4CC[C@](N)(COP(=O)(O)O)C4)ccc3C2)cn1 |
| InChI | InChI=1S/C22H32N3O5P/c1-25-12-17(11-24-25)14-29-13-16-2-3-19-9-20(5-4-18(19)8-16)21-6-7-22(23,10-21)15-30-31(26,27)28/h4-5,9,11-12,16,21H,2-3,6-8,10,13-15,23H2,1H3,(H2,26,27,28)/t16-,21+,22-/m1/s1 |
| InChIKey | TXWJKTUCVQIFGS-URZJWIJPSA-N |
| XLogP | 2.82 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|