C22H30NO5PS — CID 131953616
[(1R,3S)-1-amino-3-[(6R)-6-(thiophen-2-ylmethoxymethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate (PubChem CID 131953616) has the molecular formula C22H30NO5PS and a molecular weight of 451.53 g/mol. Its IUPAC name is [(1R,3S)-1-amino-3-[(6R)-6-(thiophen-2-ylmethoxymethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate.
| Compound Name | [(1R,3S)-1-amino-3-[(6R)-6-(thiophen-2-ylmethoxymethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 131953616 |
| Molecular Formula | C22H30NO5PS |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | [(1R,3S)-1-amino-3-[(6R)-6-(thiophen-2-ylmethoxymethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate |
| SMILES | N[C@]1(COP(=O)(O)O)CC[C@H](c2ccc3c(c2)CC[C@@H](COCc2cccs2)C3)C1 |
| InChI | InChI=1S/C22H30NO5PS/c23-22(15-28-29(24,25)26)8-7-20(12-22)19-6-5-17-10-16(3-4-18(17)11-19)13-27-14-21-2-1-9-30-21/h1-2,5-6,9,11,16,20H,3-4,7-8,10,12-15,23H2,(H2,24,25,26)/t16-,20+,22-/m1/s1 |
| InChIKey | YHUYRJIHJGQNIH-QGCDCVKKSA-N |
| XLogP | 4.14 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|