C24H34NO5PS — CID 131953629
[(1R,3S)-1-amino-3-[(6R)-6-[(4,5-dimethylthiophen-2-yl)methoxymethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate (PubChem CID 131953629) has the molecular formula C24H34NO5PS and a molecular weight of 479.58 g/mol. Its IUPAC name is [(1R,3S)-1-amino-3-[(6R)-6-[(4,5-dimethylthiophen-2-yl)methoxymethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate.
| Compound Name | [(1R,3S)-1-amino-3-[(6R)-6-[(4,5-dimethylthiophen-2-yl)methoxymethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 131953629 |
| Molecular Formula | C24H34NO5PS |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | [(1R,3S)-1-amino-3-[(6R)-6-[(4,5-dimethylthiophen-2-yl)methoxymethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate |
| SMILES | Cc1cc(COC[C@@H]2CCc3cc([C@H]4CC[C@](N)(COP(=O)(O)O)C4)ccc3C2)sc1C |
| InChI | InChI=1S/C24H34NO5PS/c1-16-9-23(32-17(16)2)14-29-13-18-3-4-20-11-21(6-5-19(20)10-18)22-7-8-24(25,12-22)15-30-31(26,27)28/h5-6,9,11,18,22H,3-4,7-8,10,12-15,25H2,1-2H3,(H2,26,27,28)/t18-,22+,24-/m1/s1 |
| InChIKey | RVJFCSVEYMOOFK-RVSNTGDXSA-N |
| XLogP | 4.76 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|