C24H29F3NO6P — CID 131953637
[(1R,3S)-1-amino-3-[(6R)-6-[[3-(trifluoromethoxy)phenoxy]methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate (PubChem CID 131953637) has the molecular formula C24H29F3NO6P and a molecular weight of 515.47 g/mol. Its IUPAC name is [(1R,3S)-1-amino-3-[(6R)-6-[[3-(trifluoromethoxy)phenoxy]methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate.
| Compound Name | [(1R,3S)-1-amino-3-[(6R)-6-[[3-(trifluoromethoxy)phenoxy]methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 131953637 |
| Molecular Formula | C24H29F3NO6P |
| Molecular Weight | 515.47 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | [(1R,3S)-1-amino-3-[(6R)-6-[[3-(trifluoromethoxy)phenoxy]methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate |
| SMILES | N[C@]1(COP(=O)(O)O)CC[C@H](c2ccc3c(c2)CC[C@@H](COc2cccc(OC(F)(F)F)c2)C3)C1 |
| InChI | InChI=1S/C24H29F3NO6P/c25-24(26,27)34-22-3-1-2-21(12-22)32-14-16-4-5-18-11-19(7-6-17(18)10-16)20-8-9-23(28,13-20)15-33-35(29,30)31/h1-3,6-7,11-12,16,20H,4-5,8-10,13-15,28H2,(H2,29,30,31)/t16-,20+,23-/m1/s1 |
| InChIKey | NZKZHORILZMUBN-NIJIEXERSA-N |
| XLogP | 4.84 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.47 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|