C24H32NO5PS — CID 131953667
[(1R,3S)-1-amino-3-[(6R)-6-[(3-methoxyphenyl)sulfanylmethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate (PubChem CID 131953667) has the molecular formula C24H32NO5PS and a molecular weight of 477.56 g/mol. Its IUPAC name is [(1R,3S)-1-amino-3-[(6R)-6-[(3-methoxyphenyl)sulfanylmethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate.
| Compound Name | [(1R,3S)-1-amino-3-[(6R)-6-[(3-methoxyphenyl)sulfanylmethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 131953667 |
| Molecular Formula | C24H32NO5PS |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | [(1R,3S)-1-amino-3-[(6R)-6-[(3-methoxyphenyl)sulfanylmethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate |
| SMILES | COc1cccc(SC[C@@H]2CCc3cc([C@H]4CC[C@](N)(COP(=O)(O)O)C4)ccc3C2)c1 |
| InChI | InChI=1S/C24H32NO5PS/c1-29-22-3-2-4-23(13-22)32-15-17-5-6-19-12-20(8-7-18(19)11-17)21-9-10-24(25,14-21)16-30-31(26,27)28/h2-4,7-8,12-13,17,21H,5-6,9-11,14-16,25H2,1H3,(H2,26,27,28)/t17-,21+,24-/m1/s1 |
| InChIKey | LMYHLCLZWOIUDH-QATBIIFWSA-N |
| XLogP | 4.67 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|