C24H31FNO5P — CID 131953692
[(1R,3S)-1-amino-3-[(6S)-6-[(3-fluoro-4-methoxyphenyl)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate (PubChem CID 131953692) has the molecular formula C24H31FNO5P and a molecular weight of 463.49 g/mol. Its IUPAC name is [(1R,3S)-1-amino-3-[(6S)-6-[(3-fluoro-4-methoxyphenyl)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate.
| Compound Name | [(1R,3S)-1-amino-3-[(6S)-6-[(3-fluoro-4-methoxyphenyl)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 131953692 |
| Molecular Formula | C24H31FNO5P |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | [(1R,3S)-1-amino-3-[(6S)-6-[(3-fluoro-4-methoxyphenyl)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate |
| SMILES | COc1ccc(C[C@@H]2CCc3cc([C@H]4CC[C@](N)(COP(=O)(O)O)C4)ccc3C2)cc1F |
| InChI | InChI=1S/C24H31FNO5P/c1-30-23-7-3-17(12-22(23)25)10-16-2-4-19-13-20(6-5-18(19)11-16)21-8-9-24(26,14-21)15-31-32(27,28)29/h3,5-7,12-13,16,21H,2,4,8-11,14-15,26H2,1H3,(H2,27,28,29)/t16-,21-,24+/m0/s1 |
| InChIKey | XBAVBHBZHTVFNG-LYAKXMMSSA-N |
| XLogP | 4.26 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|