C21H35N2O4P — CID 131953744
[1-amino-3-(6-hexyl-5,6,7,8-tetrahydroquinolin-2-yl)cyclopentyl]methyl dihydrogen phosphate (PubChem CID 131953744) has the molecular formula C21H35N2O4P and a molecular weight of 410.50 g/mol. Its IUPAC name is [1-amino-3-(6-hexyl-5,6,7,8-tetrahydroquinolin-2-yl)cyclopentyl]methyl dihydrogen phosphate.
| Compound Name | [1-amino-3-(6-hexyl-5,6,7,8-tetrahydroquinolin-2-yl)cyclopentyl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 131953744 |
| Molecular Formula | C21H35N2O4P |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | [1-amino-3-(6-hexyl-5,6,7,8-tetrahydroquinolin-2-yl)cyclopentyl]methyl dihydrogen phosphate |
| SMILES | CCCCCCC1CCc2nc(C3CCC(N)(COP(=O)(O)O)C3)ccc2C1 |
| InChI | InChI=1S/C21H35N2O4P/c1-2-3-4-5-6-16-7-9-19-17(13-16)8-10-20(23-19)18-11-12-21(22,14-18)15-27-28(24,25)26/h8,10,16,18H,2-7,9,11-15,22H2,1H3,(H2,24,25,26) |
| InChIKey | MNNPLMJXXOIUPQ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|