C23H24FN3O6 — CID 131953878
N-(3,4-dimethoxyphenyl)-6-fluoro-1-[5-(hydroxyamino)-5-oxopentyl]-4-oxoquinoline-3-carboxamide (PubChem CID 131953878) has the molecular formula C23H24FN3O6 and a molecular weight of 457.46 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-6-fluoro-1-[5-(hydroxyamino)-5-oxopentyl]-4-oxoquinoline-3-carboxamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-6-fluoro-1-[5-(hydroxyamino)-5-oxopentyl]-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 131953878 |
| Molecular Formula | C23H24FN3O6 |
| Molecular Weight | 457.46 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-6-fluoro-1-[5-(hydroxyamino)-5-oxopentyl]-4-oxoquinoline-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cn(CCCCC(=O)NO)c3ccc(F)cc3c2=O)cc1OC |
| InChI | InChI=1S/C23H24FN3O6/c1-32-19-9-7-15(12-20(19)33-2)25-23(30)17-13-27(10-4-3-5-21(28)26-31)18-8-6-14(24)11-16(18)22(17)29/h6-9,11-13,31H,3-5,10H2,1-2H3,(H,25,30)(H,26,28) |
| InChIKey | PFKRILJOMKDSPZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|