C24H32N6O3 — CID 131954067
2-[4-oxo-4-[4-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)piperidin-1-yl]butyl]-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-4-one (PubChem CID 131954067) has the molecular formula C24H32N6O3 and a molecular weight of 452.56 g/mol. Its IUPAC name is 2-[4-oxo-4-[4-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)piperidin-1-yl]butyl]-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-4-one.
| Compound Name | 2-[4-oxo-4-[4-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)piperidin-1-yl]butyl]-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 131954067 |
| Molecular Formula | C24H32N6O3 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | 2-[4-oxo-4-[4-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)piperidin-1-yl]butyl]-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-4-one |
| SMILES | O=C1NC(CCCC(=O)N2CCC(c3nnc(-c4cccnc4)o3)CC2)NC2CCCCC12 |
| InChI | InChI=1S/C24H32N6O3/c31-21(9-3-8-20-26-19-7-2-1-6-18(19)22(32)27-20)30-13-10-16(11-14-30)23-28-29-24(33-23)17-5-4-12-25-15-17/h4-5,12,15-16,18-20,26H,1-3,6-11,13-14H2,(H,27,32) |
| InChIKey | ZBTULDGDMWITNJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 113.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |