C27H37N5O4 — CID 131954084
N-[4-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]cyclohexyl]-4-(4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-2-yl)butanamide (PubChem CID 131954084) has the molecular formula C27H37N5O4 and a molecular weight of 495.62 g/mol. Its IUPAC name is N-[4-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]cyclohexyl]-4-(4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-2-yl)butanamide.
| Compound Name | N-[4-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]cyclohexyl]-4-(4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-2-yl)butanamide |
|---|---|
| PubChem CID | 131954084 |
| Molecular Formula | C27H37N5O4 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | N-[4-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]cyclohexyl]-4-(4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-2-yl)butanamide |
| SMILES | COc1ccc(-c2nnc(C3CCC(NC(=O)CCCC4NC(=O)C5CCCCC5N4)CC3)o2)cc1 |
| InChI | InChI=1S/C27H37N5O4/c1-35-20-15-11-18(12-16-20)27-32-31-26(36-27)17-9-13-19(14-10-17)28-24(33)8-4-7-23-29-22-6-3-2-5-21(22)25(34)30-23/h11-12,15-17,19,21-23,29H,2-10,13-14H2,1H3,(H,28,33)(H,30,34) |
| InChIKey | ZGZAOPHCGYYJAF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |