C26H35N5O4S — CID 131954170
N-[4-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]cyclohexyl]-3-[(4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-2-yl)sulfanyl]propanamide (PubChem CID 131954170) has the molecular formula C26H35N5O4S and a molecular weight of 513.66 g/mol. Its IUPAC name is N-[4-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]cyclohexyl]-3-[(4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-2-yl)sulfanyl]propanamide.
| Compound Name | N-[4-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]cyclohexyl]-3-[(4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-2-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 131954170 |
| Molecular Formula | C26H35N5O4S |
| Molecular Weight | 513.66 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | N-[4-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]cyclohexyl]-3-[(4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-2-yl)sulfanyl]propanamide |
| SMILES | COc1ccc(-c2nnc(C3CCC(NC(=O)CCSC4NC(=O)C5CCCCC5N4)CC3)o2)cc1 |
| InChI | InChI=1S/C26H35N5O4S/c1-34-19-12-8-17(9-13-19)25-31-30-24(35-25)16-6-10-18(11-7-16)27-22(32)14-15-36-26-28-21-5-3-2-4-20(21)23(33)29-26/h8-9,12-13,16,18,20-21,26,28H,2-7,10-11,14-15H2,1H3,(H,27,32)(H,29,33) |
| InChIKey | OGBYZWKFKYNAIR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.66 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |