C20H32N6O — CID 131954263
2-[[(1R,2S)-2-aminocyclohexyl]amino]-4-(3-methylanilino)-2,3,4,4a,6,7,8,8a-octahydro-1H-pyrido[4,3-d]pyrimidin-5-one (PubChem CID 131954263) has the molecular formula C20H32N6O and a molecular weight of 372.52 g/mol. Its IUPAC name is 2-[[(1R,2S)-2-aminocyclohexyl]amino]-4-(3-methylanilino)-2,3,4,4a,6,7,8,8a-octahydro-1H-pyrido[4,3-d]pyrimidin-5-one.
| Compound Name | 2-[[(1R,2S)-2-aminocyclohexyl]amino]-4-(3-methylanilino)-2,3,4,4a,6,7,8,8a-octahydro-1H-pyrido[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 131954263 |
| Molecular Formula | C20H32N6O |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | 2-[[(1R,2S)-2-aminocyclohexyl]amino]-4-(3-methylanilino)-2,3,4,4a,6,7,8,8a-octahydro-1H-pyrido[4,3-d]pyrimidin-5-one |
| SMILES | Cc1cccc(NC2NC(N[C@@H]3CCCC[C@@H]3N)NC3CCNC(=O)C32)c1 |
| InChI | InChI=1S/C20H32N6O/c1-12-5-4-6-13(11-12)23-18-17-16(9-10-22-19(17)27)25-20(26-18)24-15-8-3-2-7-14(15)21/h4-6,11,14-18,20,23-26H,2-3,7-10,21H2,1H3,(H,22,27)/t14-,15+,16?,17?,18?,20?/m0/s1 |
| InChIKey | PDVGOYZFKVOQFM-KJJLILKLSA-N |
| XLogP | 0.57 |
| TPSA | 103.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |