C15H21N3O — CID 131955905
6-cyclooct-2-en-1-yl-2,5,7,8-tetrahydropyrido[4,3-c]pyridazin-3-one (PubChem CID 131955905) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 6-cyclooct-2-en-1-yl-2,5,7,8-tetrahydropyrido[4,3-c]pyridazin-3-one.
| Compound Name | 6-cyclooct-2-en-1-yl-2,5,7,8-tetrahydropyrido[4,3-c]pyridazin-3-one |
|---|---|
| PubChem CID | 131955905 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 6-cyclooct-2-en-1-yl-2,5,7,8-tetrahydropyrido[4,3-c]pyridazin-3-one |
| SMILES | O=c1cc2c(n[nH]1)CCN(C1C=CCCCCC1)C2 |
| InChI | InChI=1S/C15H21N3O/c19-15-10-12-11-18(9-8-14(12)16-17-15)13-6-4-2-1-3-5-7-13/h4,6,10,13H,1-3,5,7-9,11H2,(H,17,19) |
| InChIKey | ZWUDUGVMARUNRV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|