C15H20O7S — CID 13195895
methyl (4R,5S)-2,2-dimethyl-5-[(4-methylphenyl)sulfonyloxymethyl]-1,3-dioxolane-4-carboxylate (PubChem CID 13195895) has the molecular formula C15H20O7S and a molecular weight of 344.39 g/mol. Its IUPAC name is methyl (4R,5S)-2,2-dimethyl-5-[(4-methylphenyl)sulfonyloxymethyl]-1,3-dioxolane-4-carboxylate.
| Compound Name | methyl (4R,5S)-2,2-dimethyl-5-[(4-methylphenyl)sulfonyloxymethyl]-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 13195895 |
| Molecular Formula | C15H20O7S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | methyl (4R,5S)-2,2-dimethyl-5-[(4-methylphenyl)sulfonyloxymethyl]-1,3-dioxolane-4-carboxylate |
| SMILES | COC(=O)[C@@H]1OC(C)(C)O[C@H]1COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H20O7S/c1-10-5-7-11(8-6-10)23(17,18)20-9-12-13(14(16)19-4)22-15(2,3)21-12/h5-8,12-13H,9H2,1-4H3/t12-,13+/m0/s1 |
| InChIKey | OBEFCUCGJJERMV-QWHCGFSZSA-N |
| XLogP | 1.39 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|