C13H22F3N3O2 — CID 131960629
(3aR,6aS)-N-(4-amino-1,1,1-trifluorobutan-2-yl)-3,3-dimethyl-3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-1-carboxamide (PubChem CID 131960629) has the molecular formula C13H22F3N3O2 and a molecular weight of 309.33 g/mol. Its IUPAC name is (3aR,6aS)-N-(4-amino-1,1,1-trifluorobutan-2-yl)-3,3-dimethyl-3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-1-carboxamide.
| Compound Name | (3aR,6aS)-N-(4-amino-1,1,1-trifluorobutan-2-yl)-3,3-dimethyl-3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-1-carboxamide |
|---|---|
| PubChem CID | 131960629 |
| Molecular Formula | C13H22F3N3O2 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | (3aR,6aS)-N-(4-amino-1,1,1-trifluorobutan-2-yl)-3,3-dimethyl-3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-1-carboxamide |
| SMILES | CC1(C)CN(C(=O)NC(CCN)C(F)(F)F)[C@@H]2COC[C@@H]21 |
| InChI | InChI=1S/C13H22F3N3O2/c1-12(2)7-19(9-6-21-5-8(9)12)11(20)18-10(3-4-17)13(14,15)16/h8-10H,3-7,17H2,1-2H3,(H,18,20)/t8-,9+,10?/m0/s1 |
| InChIKey | YDEOVINXEQUHLY-QIIDTADFSA-N |
| XLogP | 1.33 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |