About 4-phenyl-4,5-dihydro-1,3-thiazol-2-amine
4-phenyl-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 13196077) has the molecular formula C9H10N2S
and a molecular weight of 178.26 g/mol. Its IUPAC name is 4-phenyl-4,5-dihydro-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-phenyl-4,5-dihydro-1,3-thiazol-2-amine |
| PubChem CID | 13196077 |
| Molecular Formula | C9H10N2S |
| Molecular Weight | 178.26 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 4-phenyl-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | NC1=NC(c2ccccc2)CS1 |
| InChI | InChI=1S/C9H10N2S/c10-9-11-8(6-12-9)7-4-2-1-3-5-7/h1-5,8H,6H2,(H2,10,11) |
| InChIKey | VMXKVUZBDSURAV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.26 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-phenyl-4,5-dihydro-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-4,5-dihydro-1,3-thiazol-2-amine?
The IUPAC name of 4-phenyl-4,5-dihydro-1,3-thiazol-2-amine (CID 13196077) is 4-phenyl-4,5-dihydro-1,3-thiazol-2-amine.
What is the SMILES notation for 4-phenyl-4,5-dihydro-1,3-thiazol-2-amine?
The canonical SMILES for 4-phenyl-4,5-dihydro-1,3-thiazol-2-amine is NC1=NC(c2ccccc2)CS1.
What is the InChIKey of 4-phenyl-4,5-dihydro-1,3-thiazol-2-amine?
The InChIKey is VMXKVUZBDSURAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2S/c10-9-11-8(6-12-9)7-4-2-1-3-5-7/h1-5,8H,6H2,(H2,10,11).
What are the key properties of 4-phenyl-4,5-dihydro-1,3-thiazol-2-amine?
4-phenyl-4,5-dihydro-1,3-thiazol-2-amine has a molecular weight of 178.26 g/mol, XLogP of 1.79, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-4,5-dihydro-1,3-thiazol-2-amine is sourced from PubChem (CID 13196077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).