C15H20F3N3O2 — CID 131960917
N-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine-1-carboxamide (PubChem CID 131960917) has the molecular formula C15H20F3N3O2 and a molecular weight of 331.34 g/mol. Its IUPAC name is N-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine-1-carboxamide.
| Compound Name | N-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine-1-carboxamide |
|---|---|
| PubChem CID | 131960917 |
| Molecular Formula | C15H20F3N3O2 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | N-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine-1-carboxamide |
| SMILES | CCc1noc(CC)c1CNC(=O)N1CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H20F3N3O2/c1-3-12-11(13(4-2)23-20-12)9-19-14(22)21-7-5-10(6-8-21)15(16,17)18/h5H,3-4,6-9H2,1-2H3,(H,19,22) |
| InChIKey | NUUBADQPQUEICZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|