About 2-[3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]phenyl]aniline
2-[3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]phenyl]aniline (PubChem CID 131961220) has the molecular formula C16H18N2O2S
and a molecular weight of 302.40 g/mol. Its IUPAC name is 2-[3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]phenyl]aniline.
Molecular Properties
| Compound Name | 2-[3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]phenyl]aniline |
| PubChem CID | 131961220 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2-[3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]phenyl]aniline |
| SMILES | Nc1ccccc1-c1cccc(CN2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C16H18N2O2S/c17-16-8-2-1-7-15(16)14-6-3-5-13(11-14)12-18-9-4-10-21(18,19)20/h1-3,5-8,11H,4,9-10,12,17H2 |
| InChIKey | XKCZRQZHJBIVJW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]phenyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]phenyl]aniline?
The IUPAC name of 2-[3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]phenyl]aniline (CID 131961220) is 2-[3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]phenyl]aniline.
What is the SMILES notation for 2-[3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]phenyl]aniline?
The canonical SMILES for 2-[3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]phenyl]aniline is Nc1ccccc1-c1cccc(CN2CCCS2(=O)=O)c1.
What is the InChIKey of 2-[3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]phenyl]aniline?
The InChIKey is XKCZRQZHJBIVJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O2S/c17-16-8-2-1-7-15(16)14-6-3-5-13(11-14)12-18-9-4-10-21(18,19)20/h1-3,5-8,11H,4,9-10,12,17H2.
What are the key properties of 2-[3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]phenyl]aniline?
2-[3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]phenyl]aniline has a molecular weight of 302.40 g/mol, XLogP of 2.47, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]phenyl]aniline is sourced from PubChem (CID 131961220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).