C14H12F3N7 — CID 131961481
6-(5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-7,8-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 131961481) has the molecular formula C14H12F3N7 and a molecular weight of 335.29 g/mol. Its IUPAC name is 6-(5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-7,8-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 6-(5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-7,8-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 131961481 |
| Molecular Formula | C14H12F3N7 |
| Molecular Weight | 335.29 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 6-(5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-7,8-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | Cc1c(N2Cc3cncnc3C2)nn2c(C(F)(F)F)nnc2c1C |
| InChI | InChI=1S/C14H12F3N7/c1-7-8(2)12(23-4-9-3-18-6-19-10(9)5-23)22-24-11(7)20-21-13(24)14(15,16)17/h3,6H,4-5H2,1-2H3 |
| InChIKey | GLYOKEINFGZUDP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 72.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |