C17H22N4O4 — CID 131961759
2-[2-(2,6-dimethylphenoxy)ethyl]-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-7-carboxamide (PubChem CID 131961759) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is 2-[2-(2,6-dimethylphenoxy)ethyl]-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-7-carboxamide.
| Compound Name | 2-[2-(2,6-dimethylphenoxy)ethyl]-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 131961759 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 2-[2-(2,6-dimethylphenoxy)ethyl]-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-7-carboxamide |
| SMILES | Cc1cccc(C)c1OCCN1C(=O)C2CN(C(N)=O)CCN2C1=O |
| InChI | InChI=1S/C17H22N4O4/c1-11-4-3-5-12(2)14(11)25-9-8-21-15(22)13-10-19(16(18)23)6-7-20(13)17(21)24/h3-5,13H,6-10H2,1-2H3,(H2,18,23) |
| InChIKey | VXTMXTBOKDYNII-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|