C14H20ClNO3S — CID 131961959
3-[[1-(3-chlorophenyl)propylamino]methyl]-1,1-dioxothiolan-3-ol (PubChem CID 131961959) has the molecular formula C14H20ClNO3S and a molecular weight of 317.84 g/mol. Its IUPAC name is 3-[[1-(3-chlorophenyl)propylamino]methyl]-1,1-dioxothiolan-3-ol.
| Compound Name | 3-[[1-(3-chlorophenyl)propylamino]methyl]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 131961959 |
| Molecular Formula | C14H20ClNO3S |
| Molecular Weight | 317.84 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 3-[[1-(3-chlorophenyl)propylamino]methyl]-1,1-dioxothiolan-3-ol |
| SMILES | CCC(NCC1(O)CCS(=O)(=O)C1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H20ClNO3S/c1-2-13(11-4-3-5-12(15)8-11)16-9-14(17)6-7-20(18,19)10-14/h3-5,8,13,16-17H,2,6-7,9-10H2,1H3 |
| InChIKey | SGCDZBODEKFREG-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.84 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |