About 1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-N-[2-(1-methyltriazol-4-yl)ethyl]ethanamine
1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-N-[2-(1-methyltriazol-4-yl)ethyl]ethanamine (PubChem CID 131962153) has the molecular formula C16H18BrN5S
and a molecular weight of 392.33 g/mol. Its IUPAC name is 1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-N-[2-(1-methyltriazol-4-yl)ethyl]ethanamine.
Molecular Properties
| Compound Name | 1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-N-[2-(1-methyltriazol-4-yl)ethyl]ethanamine |
| PubChem CID | 131962153 |
| Molecular Formula | C16H18BrN5S |
| Molecular Weight | 392.33 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | 1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-N-[2-(1-methyltriazol-4-yl)ethyl]ethanamine |
| SMILES | CC(NCCc1cn(C)nn1)c1nc(-c2ccc(Br)cc2)cs1 |
| InChI | InChI=1S/C16H18BrN5S/c1-11(18-8-7-14-9-22(2)21-20-14)16-19-15(10-23-16)12-3-5-13(17)6-4-12/h3-6,9-11,18H,7-8H2,1-2H3 |
| InChIKey | PXKRDQUBEUKCPI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.33 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-N-[2-(1-methyltriazol-4-yl)ethyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-N-[2-(1-methyltriazol-4-yl)ethyl]ethanamine?
The IUPAC name of 1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-N-[2-(1-methyltriazol-4-yl)ethyl]ethanamine (CID 131962153) is 1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-N-[2-(1-methyltriazol-4-yl)ethyl]ethanamine.
What is the SMILES notation for 1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-N-[2-(1-methyltriazol-4-yl)ethyl]ethanamine?
The canonical SMILES for 1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-N-[2-(1-methyltriazol-4-yl)ethyl]ethanamine is CC(NCCc1cn(C)nn1)c1nc(-c2ccc(Br)cc2)cs1.
What is the InChIKey of 1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-N-[2-(1-methyltriazol-4-yl)ethyl]ethanamine?
The InChIKey is PXKRDQUBEUKCPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18BrN5S/c1-11(18-8-7-14-9-22(2)21-20-14)16-19-15(10-23-16)12-3-5-13(17)6-4-12/h3-6,9-11,18H,7-8H2,1-2H3.
What are the key properties of 1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-N-[2-(1-methyltriazol-4-yl)ethyl]ethanamine?
1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-N-[2-(1-methyltriazol-4-yl)ethyl]ethanamine has a molecular weight of 392.33 g/mol, XLogP of 3.59, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-N-[2-(1-methyltriazol-4-yl)ethyl]ethanamine is sourced from PubChem (CID 131962153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).