C16H18N6O — CID 131962566
4-[3-[(6-methyl-2-pyridin-2-ylpyrimidin-4-yl)amino]propyl]-1,4-dihydropyrazol-5-one (PubChem CID 131962566) has the molecular formula C16H18N6O and a molecular weight of 310.36 g/mol. Its IUPAC name is 4-[3-[(6-methyl-2-pyridin-2-ylpyrimidin-4-yl)amino]propyl]-1,4-dihydropyrazol-5-one.
| Compound Name | 4-[3-[(6-methyl-2-pyridin-2-ylpyrimidin-4-yl)amino]propyl]-1,4-dihydropyrazol-5-one |
|---|---|
| PubChem CID | 131962566 |
| Molecular Formula | C16H18N6O |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 4-[3-[(6-methyl-2-pyridin-2-ylpyrimidin-4-yl)amino]propyl]-1,4-dihydropyrazol-5-one |
| SMILES | Cc1cc(NCCCC2C=NNC2=O)nc(-c2ccccn2)n1 |
| InChI | InChI=1S/C16H18N6O/c1-11-9-14(18-8-4-5-12-10-19-22-16(12)23)21-15(20-11)13-6-2-3-7-17-13/h2-3,6-7,9-10,12H,4-5,8H2,1H3,(H,22,23)(H,18,20,21) |
| InChIKey | WYJBWJLAIFWXTG-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|