About 9-[2,6-di(propan-2-yl)pyrimidin-4-yl]-3-oxa-9-azaspiro[5.5]undecane
9-[2,6-di(propan-2-yl)pyrimidin-4-yl]-3-oxa-9-azaspiro[5.5]undecane (PubChem CID 131963146) has the molecular formula C19H31N3O
and a molecular weight of 317.48 g/mol. Its IUPAC name is 9-[2,6-di(propan-2-yl)pyrimidin-4-yl]-3-oxa-9-azaspiro[5.5]undecane.
Molecular Properties
| Compound Name | 9-[2,6-di(propan-2-yl)pyrimidin-4-yl]-3-oxa-9-azaspiro[5.5]undecane |
| PubChem CID | 131963146 |
| Molecular Formula | C19H31N3O |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.25 |
| IUPAC Name | 9-[2,6-di(propan-2-yl)pyrimidin-4-yl]-3-oxa-9-azaspiro[5.5]undecane |
| SMILES | CC(C)c1cc(N2CCC3(CCOCC3)CC2)nc(C(C)C)n1 |
| InChI | InChI=1S/C19H31N3O/c1-14(2)16-13-17(21-18(20-16)15(3)4)22-9-5-19(6-10-22)7-11-23-12-8-19/h13-15H,5-12H2,1-4H3 |
| InChIKey | INBBTQMLFKJERH-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-[2,6-di(propan-2-yl)pyrimidin-4-yl]-3-oxa-9-azaspiro[5.5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[2,6-di(propan-2-yl)pyrimidin-4-yl]-3-oxa-9-azaspiro[5.5]undecane?
The IUPAC name of 9-[2,6-di(propan-2-yl)pyrimidin-4-yl]-3-oxa-9-azaspiro[5.5]undecane (CID 131963146) is 9-[2,6-di(propan-2-yl)pyrimidin-4-yl]-3-oxa-9-azaspiro[5.5]undecane.
What is the SMILES notation for 9-[2,6-di(propan-2-yl)pyrimidin-4-yl]-3-oxa-9-azaspiro[5.5]undecane?
The canonical SMILES for 9-[2,6-di(propan-2-yl)pyrimidin-4-yl]-3-oxa-9-azaspiro[5.5]undecane is CC(C)c1cc(N2CCC3(CCOCC3)CC2)nc(C(C)C)n1.
What is the InChIKey of 9-[2,6-di(propan-2-yl)pyrimidin-4-yl]-3-oxa-9-azaspiro[5.5]undecane?
The InChIKey is INBBTQMLFKJERH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H31N3O/c1-14(2)16-13-17(21-18(20-16)15(3)4)22-9-5-19(6-10-22)7-11-23-12-8-19/h13-15H,5-12H2,1-4H3.
What are the key properties of 9-[2,6-di(propan-2-yl)pyrimidin-4-yl]-3-oxa-9-azaspiro[5.5]undecane?
9-[2,6-di(propan-2-yl)pyrimidin-4-yl]-3-oxa-9-azaspiro[5.5]undecane has a molecular weight of 317.48 g/mol, XLogP of 4.12, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[2,6-di(propan-2-yl)pyrimidin-4-yl]-3-oxa-9-azaspiro[5.5]undecane is sourced from PubChem (CID 131963146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).