About N-[1-[(2,2-difluorocyclohexyl)methyl]piperidin-4-yl]-N-methylethanesulfonamide
N-[1-[(2,2-difluorocyclohexyl)methyl]piperidin-4-yl]-N-methylethanesulfonamide (PubChem CID 131963268) has the molecular formula C15H28F2N2O2S
and a molecular weight of 338.46 g/mol. Its IUPAC name is N-[1-[(2,2-difluorocyclohexyl)methyl]piperidin-4-yl]-N-methylethanesulfonamide.
Molecular Properties
| Compound Name | N-[1-[(2,2-difluorocyclohexyl)methyl]piperidin-4-yl]-N-methylethanesulfonamide |
| PubChem CID | 131963268 |
| Molecular Formula | C15H28F2N2O2S |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | N-[1-[(2,2-difluorocyclohexyl)methyl]piperidin-4-yl]-N-methylethanesulfonamide |
| SMILES | CCS(=O)(=O)N(C)C1CCN(CC2CCCCC2(F)F)CC1 |
| InChI | InChI=1S/C15H28F2N2O2S/c1-3-22(20,21)18(2)14-7-10-19(11-8-14)12-13-6-4-5-9-15(13,16)17/h13-14H,3-12H2,1-2H3 |
| InChIKey | JSQMWTDYAJDSAF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-[(2,2-difluorocyclohexyl)methyl]piperidin-4-yl]-N-methylethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[(2,2-difluorocyclohexyl)methyl]piperidin-4-yl]-N-methylethanesulfonamide?
The IUPAC name of N-[1-[(2,2-difluorocyclohexyl)methyl]piperidin-4-yl]-N-methylethanesulfonamide (CID 131963268) is N-[1-[(2,2-difluorocyclohexyl)methyl]piperidin-4-yl]-N-methylethanesulfonamide.
What is the SMILES notation for N-[1-[(2,2-difluorocyclohexyl)methyl]piperidin-4-yl]-N-methylethanesulfonamide?
The canonical SMILES for N-[1-[(2,2-difluorocyclohexyl)methyl]piperidin-4-yl]-N-methylethanesulfonamide is CCS(=O)(=O)N(C)C1CCN(CC2CCCCC2(F)F)CC1.
What is the InChIKey of N-[1-[(2,2-difluorocyclohexyl)methyl]piperidin-4-yl]-N-methylethanesulfonamide?
The InChIKey is JSQMWTDYAJDSAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28F2N2O2S/c1-3-22(20,21)18(2)14-7-10-19(11-8-14)12-13-6-4-5-9-15(13,16)17/h13-14H,3-12H2,1-2H3.
What are the key properties of N-[1-[(2,2-difluorocyclohexyl)methyl]piperidin-4-yl]-N-methylethanesulfonamide?
N-[1-[(2,2-difluorocyclohexyl)methyl]piperidin-4-yl]-N-methylethanesulfonamide has a molecular weight of 338.46 g/mol, XLogP of 2.56, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[(2,2-difluorocyclohexyl)methyl]piperidin-4-yl]-N-methylethanesulfonamide is sourced from PubChem (CID 131963268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).