About N-[(2,2-difluoro-1,3-benzodioxol-4-yl)methyl]-2-methoxy-5-(methylsulfonylmethyl)aniline
N-[(2,2-difluoro-1,3-benzodioxol-4-yl)methyl]-2-methoxy-5-(methylsulfonylmethyl)aniline (PubChem CID 131963724) has the molecular formula C17H17F2NO5S
and a molecular weight of 385.39 g/mol. Its IUPAC name is N-[(2,2-difluoro-1,3-benzodioxol-4-yl)methyl]-2-methoxy-5-(methylsulfonylmethyl)aniline.
Molecular Properties
| Compound Name | N-[(2,2-difluoro-1,3-benzodioxol-4-yl)methyl]-2-methoxy-5-(methylsulfonylmethyl)aniline |
| PubChem CID | 131963724 |
| Molecular Formula | C17H17F2NO5S |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | N-[(2,2-difluoro-1,3-benzodioxol-4-yl)methyl]-2-methoxy-5-(methylsulfonylmethyl)aniline |
| SMILES | COc1ccc(CS(C)(=O)=O)cc1NCc1cccc2c1OC(F)(F)O2 |
| InChI | InChI=1S/C17H17F2NO5S/c1-23-14-7-6-11(10-26(2,21)22)8-13(14)20-9-12-4-3-5-15-16(12)25-17(18,19)24-15/h3-8,20H,9-10H2,1-2H3 |
| InChIKey | JKFJPJUWJAIAMC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[(2,2-difluoro-1,3-benzodioxol-4-yl)methyl]-2-methoxy-5-(methylsulfonylmethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,2-difluoro-1,3-benzodioxol-4-yl)methyl]-2-methoxy-5-(methylsulfonylmethyl)aniline?
The IUPAC name of N-[(2,2-difluoro-1,3-benzodioxol-4-yl)methyl]-2-methoxy-5-(methylsulfonylmethyl)aniline (CID 131963724) is N-[(2,2-difluoro-1,3-benzodioxol-4-yl)methyl]-2-methoxy-5-(methylsulfonylmethyl)aniline.
What is the SMILES notation for N-[(2,2-difluoro-1,3-benzodioxol-4-yl)methyl]-2-methoxy-5-(methylsulfonylmethyl)aniline?
The canonical SMILES for N-[(2,2-difluoro-1,3-benzodioxol-4-yl)methyl]-2-methoxy-5-(methylsulfonylmethyl)aniline is COc1ccc(CS(C)(=O)=O)cc1NCc1cccc2c1OC(F)(F)O2.
What is the InChIKey of N-[(2,2-difluoro-1,3-benzodioxol-4-yl)methyl]-2-methoxy-5-(methylsulfonylmethyl)aniline?
The InChIKey is JKFJPJUWJAIAMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17F2NO5S/c1-23-14-7-6-11(10-26(2,21)22)8-13(14)20-9-12-4-3-5-15-16(12)25-17(18,19)24-15/h3-8,20H,9-10H2,1-2H3.
What are the key properties of N-[(2,2-difluoro-1,3-benzodioxol-4-yl)methyl]-2-methoxy-5-(methylsulfonylmethyl)aniline?
N-[(2,2-difluoro-1,3-benzodioxol-4-yl)methyl]-2-methoxy-5-(methylsulfonylmethyl)aniline has a molecular weight of 385.39 g/mol, XLogP of 3.17, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,2-difluoro-1,3-benzodioxol-4-yl)methyl]-2-methoxy-5-(methylsulfonylmethyl)aniline is sourced from PubChem (CID 131963724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).