C19H22ClNO6 — CID 131964287
methyl 2-(4-chloro-2-methoxyphenyl)-2-[3-(2-hydroxyethoxy)-5-methoxyanilino]acetate (PubChem CID 131964287) has the molecular formula C19H22ClNO6 and a molecular weight of 395.84 g/mol. Its IUPAC name is methyl 2-(4-chloro-2-methoxyphenyl)-2-[3-(2-hydroxyethoxy)-5-methoxyanilino]acetate.
| Compound Name | methyl 2-(4-chloro-2-methoxyphenyl)-2-[3-(2-hydroxyethoxy)-5-methoxyanilino]acetate |
|---|---|
| PubChem CID | 131964287 |
| Molecular Formula | C19H22ClNO6 |
| Molecular Weight | 395.84 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | methyl 2-(4-chloro-2-methoxyphenyl)-2-[3-(2-hydroxyethoxy)-5-methoxyanilino]acetate |
| SMILES | COC(=O)C(Nc1cc(OC)cc(OCCO)c1)c1ccc(Cl)cc1OC |
| InChI | InChI=1S/C19H22ClNO6/c1-24-14-9-13(10-15(11-14)27-7-6-22)21-18(19(23)26-3)16-5-4-12(20)8-17(16)25-2/h4-5,8-11,18,21-22H,6-7H2,1-3H3 |
| InChIKey | BJXSBABEJIFRHN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.84 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |