About 6-(3-benzyl-3-methyl-1,2-dihydroindol-5-yl)-9-ethyl-8-(2-methylpyrimidin-5-yl)purine
6-(3-benzyl-3-methyl-1,2-dihydroindol-5-yl)-9-ethyl-8-(2-methylpyrimidin-5-yl)purine (PubChem CID 131964639) has the molecular formula C28H27N7
and a molecular weight of 461.57 g/mol. Its IUPAC name is 6-(3-benzyl-3-methyl-1,2-dihydroindol-5-yl)-9-ethyl-8-(2-methylpyrimidin-5-yl)purine.
Molecular Properties
| Compound Name | 6-(3-benzyl-3-methyl-1,2-dihydroindol-5-yl)-9-ethyl-8-(2-methylpyrimidin-5-yl)purine |
| PubChem CID | 131964639 |
| Molecular Formula | C28H27N7 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 6-(3-benzyl-3-methyl-1,2-dihydroindol-5-yl)-9-ethyl-8-(2-methylpyrimidin-5-yl)purine |
| SMILES | CCn1c(-c2cnc(C)nc2)nc2c(-c3ccc4c(c3)C(C)(Cc3ccccc3)CN4)ncnc21 |
| InChI | InChI=1S/C28H27N7/c1-4-35-26(21-14-29-18(2)30-15-21)34-25-24(32-17-33-27(25)35)20-10-11-23-22(12-20)28(3,16-31-23)13-19-8-6-5-7-9-19/h5-12,14-15,17,31H,4,13,16H2,1-3H3 |
| InChIKey | TWGCTDKQNHDIPP-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-(3-benzyl-3-methyl-1,2-dihydroindol-5-yl)-9-ethyl-8-(2-methylpyrimidin-5-yl)purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-benzyl-3-methyl-1,2-dihydroindol-5-yl)-9-ethyl-8-(2-methylpyrimidin-5-yl)purine?
The IUPAC name of 6-(3-benzyl-3-methyl-1,2-dihydroindol-5-yl)-9-ethyl-8-(2-methylpyrimidin-5-yl)purine (CID 131964639) is 6-(3-benzyl-3-methyl-1,2-dihydroindol-5-yl)-9-ethyl-8-(2-methylpyrimidin-5-yl)purine.
What is the SMILES notation for 6-(3-benzyl-3-methyl-1,2-dihydroindol-5-yl)-9-ethyl-8-(2-methylpyrimidin-5-yl)purine?
The canonical SMILES for 6-(3-benzyl-3-methyl-1,2-dihydroindol-5-yl)-9-ethyl-8-(2-methylpyrimidin-5-yl)purine is CCn1c(-c2cnc(C)nc2)nc2c(-c3ccc4c(c3)C(C)(Cc3ccccc3)CN4)ncnc21.
What is the InChIKey of 6-(3-benzyl-3-methyl-1,2-dihydroindol-5-yl)-9-ethyl-8-(2-methylpyrimidin-5-yl)purine?
The InChIKey is TWGCTDKQNHDIPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H27N7/c1-4-35-26(21-14-29-18(2)30-15-21)34-25-24(32-17-33-27(25)35)20-10-11-23-22(12-20)28(3,16-31-23)13-19-8-6-5-7-9-19/h5-12,14-15,17,31H,4,13,16H2,1-3H3.
What are the key properties of 6-(3-benzyl-3-methyl-1,2-dihydroindol-5-yl)-9-ethyl-8-(2-methylpyrimidin-5-yl)purine?
6-(3-benzyl-3-methyl-1,2-dihydroindol-5-yl)-9-ethyl-8-(2-methylpyrimidin-5-yl)purine has a molecular weight of 461.57 g/mol, XLogP of 5.20, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-benzyl-3-methyl-1,2-dihydroindol-5-yl)-9-ethyl-8-(2-methylpyrimidin-5-yl)purine is sourced from PubChem (CID 131964639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).