About 6-(3-benzyl-1,3-dimethyl-2H-indol-5-yl)-9-ethyl-8-(2-methylpyrimidin-5-yl)purine
6-(3-benzyl-1,3-dimethyl-2H-indol-5-yl)-9-ethyl-8-(2-methylpyrimidin-5-yl)purine (PubChem CID 131964761) has the molecular formula C29H29N7
and a molecular weight of 475.60 g/mol. Its IUPAC name is 6-(3-benzyl-1,3-dimethyl-2H-indol-5-yl)-9-ethyl-8-(2-methylpyrimidin-5-yl)purine.
Molecular Properties
| Compound Name | 6-(3-benzyl-1,3-dimethyl-2H-indol-5-yl)-9-ethyl-8-(2-methylpyrimidin-5-yl)purine |
| PubChem CID | 131964761 |
| Molecular Formula | C29H29N7 |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | 6-(3-benzyl-1,3-dimethyl-2H-indol-5-yl)-9-ethyl-8-(2-methylpyrimidin-5-yl)purine |
| SMILES | CCn1c(-c2cnc(C)nc2)nc2c(-c3ccc4c(c3)C(C)(Cc3ccccc3)CN4C)ncnc21 |
| InChI | InChI=1S/C29H29N7/c1-5-36-27(22-15-30-19(2)31-16-22)34-26-25(32-18-33-28(26)36)21-11-12-24-23(13-21)29(3,17-35(24)4)14-20-9-7-6-8-10-20/h6-13,15-16,18H,5,14,17H2,1-4H3 |
| InChIKey | QLPGCJYRSBNJOZ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 72.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-(3-benzyl-1,3-dimethyl-2H-indol-5-yl)-9-ethyl-8-(2-methylpyrimidin-5-yl)purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-benzyl-1,3-dimethyl-2H-indol-5-yl)-9-ethyl-8-(2-methylpyrimidin-5-yl)purine?
The IUPAC name of 6-(3-benzyl-1,3-dimethyl-2H-indol-5-yl)-9-ethyl-8-(2-methylpyrimidin-5-yl)purine (CID 131964761) is 6-(3-benzyl-1,3-dimethyl-2H-indol-5-yl)-9-ethyl-8-(2-methylpyrimidin-5-yl)purine.
What is the SMILES notation for 6-(3-benzyl-1,3-dimethyl-2H-indol-5-yl)-9-ethyl-8-(2-methylpyrimidin-5-yl)purine?
The canonical SMILES for 6-(3-benzyl-1,3-dimethyl-2H-indol-5-yl)-9-ethyl-8-(2-methylpyrimidin-5-yl)purine is CCn1c(-c2cnc(C)nc2)nc2c(-c3ccc4c(c3)C(C)(Cc3ccccc3)CN4C)ncnc21.
What is the InChIKey of 6-(3-benzyl-1,3-dimethyl-2H-indol-5-yl)-9-ethyl-8-(2-methylpyrimidin-5-yl)purine?
The InChIKey is QLPGCJYRSBNJOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H29N7/c1-5-36-27(22-15-30-19(2)31-16-22)34-26-25(32-18-33-28(26)36)21-11-12-24-23(13-21)29(3,17-35(24)4)14-20-9-7-6-8-10-20/h6-13,15-16,18H,5,14,17H2,1-4H3.
What are the key properties of 6-(3-benzyl-1,3-dimethyl-2H-indol-5-yl)-9-ethyl-8-(2-methylpyrimidin-5-yl)purine?
6-(3-benzyl-1,3-dimethyl-2H-indol-5-yl)-9-ethyl-8-(2-methylpyrimidin-5-yl)purine has a molecular weight of 475.60 g/mol, XLogP of 5.23, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-benzyl-1,3-dimethyl-2H-indol-5-yl)-9-ethyl-8-(2-methylpyrimidin-5-yl)purine is sourced from PubChem (CID 131964761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).