About 3-(1-decylindol-6-yl)-5-[(2S)-pyrrolidin-1-ium-2-yl]-1,2,4-oxadiazole chloride
3-(1-decylindol-6-yl)-5-[(2S)-pyrrolidin-1-ium-2-yl]-1,2,4-oxadiazole chloride (PubChem CID 131965082) has the molecular formula C24H35ClN4O
and a molecular weight of 431.02 g/mol. Its IUPAC name is 3-(1-decylindol-6-yl)-5-[(2S)-pyrrolidin-1-ium-2-yl]-1,2,4-oxadiazole chloride.
Molecular Properties
| Compound Name | 3-(1-decylindol-6-yl)-5-[(2S)-pyrrolidin-1-ium-2-yl]-1,2,4-oxadiazole chloride |
| PubChem CID | 131965082 |
| Molecular Formula | C24H35ClN4O |
| Molecular Weight | 431.02 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | 3-(1-decylindol-6-yl)-5-[(2S)-pyrrolidin-1-ium-2-yl]-1,2,4-oxadiazole chloride |
| SMILES | CCCCCCCCCCn1ccc2ccc(-c3noc([C@@H]4CCC[NH2+]4)n3)cc21.[Cl-] |
| InChI | InChI=1S/C24H34N4O.ClH/c1-2-3-4-5-6-7-8-9-16-28-17-14-19-12-13-20(18-22(19)28)23-26-24(29-27-23)21-11-10-15-25-21;/h12-14,17-18,21,25H,2-11,15-16H2,1H3;1H/t21-;/m0./s1 |
| InChIKey | HBEOQBUBBWKNNI-BOXHHOBZSA-N |
| XLogP | 2.23 |
| TPSA | 60.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.02 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-decylindol-6-yl)-5-[(2S)-pyrrolidin-1-ium-2-yl]-1,2,4-oxadiazole chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-decylindol-6-yl)-5-[(2S)-pyrrolidin-1-ium-2-yl]-1,2,4-oxadiazole chloride?
The IUPAC name of 3-(1-decylindol-6-yl)-5-[(2S)-pyrrolidin-1-ium-2-yl]-1,2,4-oxadiazole chloride (CID 131965082) is 3-(1-decylindol-6-yl)-5-[(2S)-pyrrolidin-1-ium-2-yl]-1,2,4-oxadiazole chloride.
What is the SMILES notation for 3-(1-decylindol-6-yl)-5-[(2S)-pyrrolidin-1-ium-2-yl]-1,2,4-oxadiazole chloride?
The canonical SMILES for 3-(1-decylindol-6-yl)-5-[(2S)-pyrrolidin-1-ium-2-yl]-1,2,4-oxadiazole chloride is CCCCCCCCCCn1ccc2ccc(-c3noc([C@@H]4CCC[NH2+]4)n3)cc21.[Cl-].
What is the InChIKey of 3-(1-decylindol-6-yl)-5-[(2S)-pyrrolidin-1-ium-2-yl]-1,2,4-oxadiazole chloride?
The InChIKey is HBEOQBUBBWKNNI-BOXHHOBZSA-N. The full InChI is InChI=1S/C24H34N4O.ClH/c1-2-3-4-5-6-7-8-9-16-28-17-14-19-12-13-20(18-22(19)28)23-26-24(29-27-23)21-11-10-15-25-21;/h12-14,17-18,21,25H,2-11,15-16H2,1H3;1H/t21-;/m0./s1.
What are the key properties of 3-(1-decylindol-6-yl)-5-[(2S)-pyrrolidin-1-ium-2-yl]-1,2,4-oxadiazole chloride?
3-(1-decylindol-6-yl)-5-[(2S)-pyrrolidin-1-ium-2-yl]-1,2,4-oxadiazole chloride has a molecular weight of 431.02 g/mol, XLogP of 2.23, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-decylindol-6-yl)-5-[(2S)-pyrrolidin-1-ium-2-yl]-1,2,4-oxadiazole chloride is sourced from PubChem (CID 131965082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).