C7H8N2O — CID 13196538
3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine (PubChem CID 13196538) has the molecular formula C7H8N2O and a molecular weight of 136.15 g/mol. Its IUPAC name is 3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine.
| Compound Name | 3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine |
|---|---|
| PubChem CID | 13196538 |
| Molecular Formula | C7H8N2O |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.06 |
| IUPAC Name | 3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine |
| SMILES | c1cnc2c(c1)OCCN2 |
| InChI | InChI=1S/C7H8N2O/c1-2-6-7(8-3-1)9-4-5-10-6/h1-3H,4-5H2,(H,8,9) |
| InChIKey | QQVXDMFULJVZLA-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |