C9H12N2O — CID 13196546
2,2-dimethyl-3,4-dihydropyrido[3,2-b][1,4]oxazine (PubChem CID 13196546) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 2,2-dimethyl-3,4-dihydropyrido[3,2-b][1,4]oxazine.
| Compound Name | 2,2-dimethyl-3,4-dihydropyrido[3,2-b][1,4]oxazine |
|---|---|
| PubChem CID | 13196546 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 2,2-dimethyl-3,4-dihydropyrido[3,2-b][1,4]oxazine |
| SMILES | CC1(C)CNc2ncccc2O1 |
| InChI | InChI=1S/C9H12N2O/c1-9(2)6-11-8-7(12-9)4-3-5-10-8/h3-5H,6H2,1-2H3,(H,10,11) |
| InChIKey | DEYCWKUHWUXFCX-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |