C24H31NO2 — CID 131965577
(E)-1-[1-[(2E,4Z)-2-ethenylhexa-2,4-dienoyl]piperidin-4-yl]-4-[(Z)-prop-1-enyl]oct-4-en-2-yn-1-one (PubChem CID 131965577) has the molecular formula C24H31NO2 and a molecular weight of 365.52 g/mol. Its IUPAC name is (E)-1-[1-[(2E,4Z)-2-ethenylhexa-2,4-dienoyl]piperidin-4-yl]-4-[(Z)-prop-1-enyl]oct-4-en-2-yn-1-one.
| Compound Name | (E)-1-[1-[(2E,4Z)-2-ethenylhexa-2,4-dienoyl]piperidin-4-yl]-4-[(Z)-prop-1-enyl]oct-4-en-2-yn-1-one |
|---|---|
| PubChem CID | 131965577 |
| Molecular Formula | C24H31NO2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | (E)-1-[1-[(2E,4Z)-2-ethenylhexa-2,4-dienoyl]piperidin-4-yl]-4-[(Z)-prop-1-enyl]oct-4-en-2-yn-1-one |
| SMILES | C=C/C(=C\C=C/C)C(=O)N1CCC(C(=O)C#CC(/C=C\C)=C/CCC)CC1 |
| InChI | InChI=1S/C24H31NO2/c1-5-9-12-20(11-7-3)14-15-23(26)22-16-18-25(19-17-22)24(27)21(8-4)13-10-6-2/h6-8,10-13,22H,4-5,9,16-19H2,1-3H3/b10-6-,11-7-,20-12+,21-13+ |
| InChIKey | HKHDTIBSFFWKDG-AQFCTFPZSA-N |
| XLogP | 4.79 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|