About (Z)-2-tert-butyl-N,5,5-trimethyl-4-methylidenehex-2-en-1-imine
(Z)-2-tert-butyl-N,5,5-trimethyl-4-methylidenehex-2-en-1-imine (PubChem CID 131965930) has the molecular formula C14H25N
and a molecular weight of 207.36 g/mol. Its IUPAC name is (Z)-2-tert-butyl-N,5,5-trimethyl-4-methylidenehex-2-en-1-imine.
Molecular Properties
| Compound Name | (Z)-2-tert-butyl-N,5,5-trimethyl-4-methylidenehex-2-en-1-imine |
| PubChem CID | 131965930 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | (Z)-2-tert-butyl-N,5,5-trimethyl-4-methylidenehex-2-en-1-imine |
| SMILES | C=C(/C=C(\C=N\C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H25N/c1-11(13(2,3)4)9-12(10-15-8)14(5,6)7/h9-10H,1H2,2-8H3/b12-9+,15-10+ |
| InChIKey | HREJUKXDANEBLO-VIKUFGDRSA-N |
| XLogP | 4.26 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-tert-butyl-N,5,5-trimethyl-4-methylidenehex-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-tert-butyl-N,5,5-trimethyl-4-methylidenehex-2-en-1-imine?
The IUPAC name of (Z)-2-tert-butyl-N,5,5-trimethyl-4-methylidenehex-2-en-1-imine (CID 131965930) is (Z)-2-tert-butyl-N,5,5-trimethyl-4-methylidenehex-2-en-1-imine.
What is the SMILES notation for (Z)-2-tert-butyl-N,5,5-trimethyl-4-methylidenehex-2-en-1-imine?
The canonical SMILES for (Z)-2-tert-butyl-N,5,5-trimethyl-4-methylidenehex-2-en-1-imine is C=C(/C=C(\C=N\C)C(C)(C)C)C(C)(C)C.
What is the InChIKey of (Z)-2-tert-butyl-N,5,5-trimethyl-4-methylidenehex-2-en-1-imine?
The InChIKey is HREJUKXDANEBLO-VIKUFGDRSA-N. The full InChI is InChI=1S/C14H25N/c1-11(13(2,3)4)9-12(10-15-8)14(5,6)7/h9-10H,1H2,2-8H3/b12-9+,15-10+.
What are the key properties of (Z)-2-tert-butyl-N,5,5-trimethyl-4-methylidenehex-2-en-1-imine?
(Z)-2-tert-butyl-N,5,5-trimethyl-4-methylidenehex-2-en-1-imine has a molecular weight of 207.36 g/mol, XLogP of 4.26, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-tert-butyl-N,5,5-trimethyl-4-methylidenehex-2-en-1-imine is sourced from PubChem (CID 131965930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).