About N-[(Z)-4,4-dimethylpent-2-en-3-yl]-2-methylprop-2-en-1-imine
N-[(Z)-4,4-dimethylpent-2-en-3-yl]-2-methylprop-2-en-1-imine (PubChem CID 131966118) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is N-[(Z)-4,4-dimethylpent-2-en-3-yl]-2-methylprop-2-en-1-imine.
Molecular Properties
| Compound Name | N-[(Z)-4,4-dimethylpent-2-en-3-yl]-2-methylprop-2-en-1-imine |
| PubChem CID | 131966118 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | N-[(Z)-4,4-dimethylpent-2-en-3-yl]-2-methylprop-2-en-1-imine |
| SMILES | C=C(C)/C=N/C(=C\C)C(C)(C)C |
| InChI | InChI=1S/C11H19N/c1-7-10(11(4,5)6)12-8-9(2)3/h7-8H,2H2,1,3-6H3/b10-7-,12-8+ |
| InChIKey | JYLWBASWRLHZFR-MITUOZDPSA-N |
| XLogP | 3.58 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-4,4-dimethylpent-2-en-3-yl]-2-methylprop-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-4,4-dimethylpent-2-en-3-yl]-2-methylprop-2-en-1-imine?
The IUPAC name of N-[(Z)-4,4-dimethylpent-2-en-3-yl]-2-methylprop-2-en-1-imine (CID 131966118) is N-[(Z)-4,4-dimethylpent-2-en-3-yl]-2-methylprop-2-en-1-imine.
What is the SMILES notation for N-[(Z)-4,4-dimethylpent-2-en-3-yl]-2-methylprop-2-en-1-imine?
The canonical SMILES for N-[(Z)-4,4-dimethylpent-2-en-3-yl]-2-methylprop-2-en-1-imine is C=C(C)/C=N/C(=C\C)C(C)(C)C.
What is the InChIKey of N-[(Z)-4,4-dimethylpent-2-en-3-yl]-2-methylprop-2-en-1-imine?
The InChIKey is JYLWBASWRLHZFR-MITUOZDPSA-N. The full InChI is InChI=1S/C11H19N/c1-7-10(11(4,5)6)12-8-9(2)3/h7-8H,2H2,1,3-6H3/b10-7-,12-8+.
What are the key properties of N-[(Z)-4,4-dimethylpent-2-en-3-yl]-2-methylprop-2-en-1-imine?
N-[(Z)-4,4-dimethylpent-2-en-3-yl]-2-methylprop-2-en-1-imine has a molecular weight of 165.28 g/mol, XLogP of 3.58, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-4,4-dimethylpent-2-en-3-yl]-2-methylprop-2-en-1-imine is sourced from PubChem (CID 131966118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).