C30H48O7 — CID 131966266
propan-2-yl 4-[(3R,5S,7R,10S,12S,13R,14S,17S)-7,12-diacetyloxy-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoate (PubChem CID 131966266) has the molecular formula C30H48O7 and a molecular weight of 520.71 g/mol. Its IUPAC name is propan-2-yl 4-[(3R,5S,7R,10S,12S,13R,14S,17S)-7,12-diacetyloxy-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoate.
| Compound Name | propan-2-yl 4-[(3R,5S,7R,10S,12S,13R,14S,17S)-7,12-diacetyloxy-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoate |
|---|---|
| PubChem CID | 131966266 |
| Molecular Formula | C30H48O7 |
| Molecular Weight | 520.71 g/mol |
| Exact Mass | 520.34 |
| IUPAC Name | propan-2-yl 4-[(3R,5S,7R,10S,12S,13R,14S,17S)-7,12-diacetyloxy-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoate |
| SMILES | CC(=O)OC1C[C@@H]2C[C@H](O)CC[C@]2(C)C2C[C@H](OC(C)=O)[C@]3(C)[C@@H](CCCC(=O)OC(C)C)CC[C@H]3C12 |
| InChI | InChI=1S/C30H48O7/c1-17(2)35-27(34)9-7-8-20-10-11-23-28-24(16-26(30(20,23)6)37-19(4)32)29(5)13-12-22(33)14-21(29)15-25(28)36-18(3)31/h17,20-26,28,33H,7-16H2,1-6H3/t20-,21-,22+,23-,24?,25?,26-,28?,29-,30+/m0/s1 |
| InChIKey | AMCNPWRCIKFBJE-ZJMHTBKISA-N |
| XLogP | 5.21 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.71 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|