C23H27F5N4O2 — CID 131966376
1-[3-[[4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl]-hydroxymethyl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl]-2-methylpropan-1-one (PubChem CID 131966376) has the molecular formula C23H27F5N4O2 and a molecular weight of 486.49 g/mol. Its IUPAC name is 1-[3-[[4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl]-hydroxymethyl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl]-2-methylpropan-1-one.
| Compound Name | 1-[3-[[4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl]-hydroxymethyl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 131966376 |
| Molecular Formula | C23H27F5N4O2 |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | 1-[3-[[4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl]-hydroxymethyl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)N1CCc2c(C(O)N3CCC(c4ccc(F)c(F)c4C(F)(F)F)CC3)n[nH]c2C1 |
| InChI | InChI=1S/C23H27F5N4O2/c1-12(2)21(33)32-10-7-15-17(11-32)29-30-20(15)22(34)31-8-5-13(6-9-31)14-3-4-16(24)19(25)18(14)23(26,27)28/h3-4,12-13,22,34H,5-11H2,1-2H3,(H,29,30) |
| InChIKey | BFASZJRDYAZLCU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 72.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |