C9H16N2 — CID 131966479
2-methyl-1-(1,2,3,6-tetrahydropyridin-5-yl)propan-1-imine (PubChem CID 131966479) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 2-methyl-1-(1,2,3,6-tetrahydropyridin-5-yl)propan-1-imine.
| Compound Name | 2-methyl-1-(1,2,3,6-tetrahydropyridin-5-yl)propan-1-imine |
|---|---|
| PubChem CID | 131966479 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 2-methyl-1-(1,2,3,6-tetrahydropyridin-5-yl)propan-1-imine |
| SMILES | [H]/N=C(/C1=CCCNC1)C(C)C |
| InChI | InChI=1S/C9H16N2/c1-7(2)9(10)8-4-3-5-11-6-8/h4,7,10-11H,3,5-6H2,1-2H3/b10-9+ |
| InChIKey | GTXOXPNNNGQGCH-MDZDMXLPSA-N |
| XLogP | 1.58 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|